C14H16N2O3S — CID 71879331
(1,1-dioxo-1,4-thiazinan-4-yl)-(1-methylindol-4-yl)methanone (PubChem CID 71879331) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-(1-methylindol-4-yl)methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(1-methylindol-4-yl)methanone |
|---|---|
| PubChem CID | 71879331 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(1-methylindol-4-yl)methanone |
| SMILES | Cn1ccc2c(C(=O)N3CCS(=O)(=O)CC3)cccc21 |
| InChI | InChI=1S/C14H16N2O3S/c1-15-6-5-11-12(3-2-4-13(11)15)14(17)16-7-9-20(18,19)10-8-16/h2-6H,7-10H2,1H3 |
| InChIKey | DLQSZVCYAQYKEA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |