C22H26N2O3S — CID 56651352
(1,1-dioxo-1,4-thiazinan-4-yl)-(9-pentylcarbazol-3-yl)methanone (PubChem CID 56651352) has the molecular formula C22H26N2O3S and a molecular weight of 398.53 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazinan-4-yl)-(9-pentylcarbazol-3-yl)methanone.
| Compound Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(9-pentylcarbazol-3-yl)methanone |
|---|---|
| PubChem CID | 56651352 |
| Molecular Formula | C22H26N2O3S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | (1,1-dioxo-1,4-thiazinan-4-yl)-(9-pentylcarbazol-3-yl)methanone |
| SMILES | CCCCCn1c2ccccc2c2cc(C(=O)N3CCS(=O)(=O)CC3)ccc21 |
| InChI | InChI=1S/C22H26N2O3S/c1-2-3-6-11-24-20-8-5-4-7-18(20)19-16-17(9-10-21(19)24)22(25)23-12-14-28(26,27)15-13-23/h4-5,7-10,16H,2-3,6,11-15H2,1H3 |
| InChIKey | YJYJBZMXVMFDSU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|