C10H13N3O2S — CID 83871664
7-methyl-2-sulfanylidene-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-4-carboxylic acid (PubChem CID 83871664) has the molecular formula C10H13N3O2S and a molecular weight of 239.30 g/mol. Its IUPAC name is 7-methyl-2-sulfanylidene-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-4-carboxylic acid.
| Compound Name | 7-methyl-2-sulfanylidene-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-4-carboxylic acid |
|---|---|
| PubChem CID | 83871664 |
| Molecular Formula | C10H13N3O2S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | 7-methyl-2-sulfanylidene-5,6,8,9-tetrahydro-1H-pyrimido[4,5-d]azepine-4-carboxylic acid |
| SMILES | CN1CCc2[nH]c(=S)nc(C(=O)O)c2CC1 |
| InChI | InChI=1S/C10H13N3O2S/c1-13-4-2-6-7(3-5-13)11-10(16)12-8(6)9(14)15/h2-5H2,1H3,(H,14,15)(H,11,12,16) |
| InChIKey | XFLWFWQNQBFYDD-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|