C9H10F3N3S — CID 82192259
6-methyl-4-(trifluoromethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 82192259) has the molecular formula C9H10F3N3S and a molecular weight of 249.26 g/mol. Its IUPAC name is 6-methyl-4-(trifluoromethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-methyl-4-(trifluoromethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 82192259 |
| Molecular Formula | C9H10F3N3S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 6-methyl-4-(trifluoromethyl)-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | CN1CCc2[nH]c(=S)nc(C(F)(F)F)c2C1 |
| InChI | InChI=1S/C9H10F3N3S/c1-15-3-2-6-5(4-15)7(9(10,11)12)14-8(16)13-6/h2-4H2,1H3,(H,13,14,16) |
| InChIKey | JLWGYDRHWTUIQH-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|