C8H12N2 — CID 58443090
1,4,5,6,7,8-hexahydropyrrolo[2,3-c]azepine (PubChem CID 58443090) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydropyrrolo[2,3-c]azepine.
| Compound Name | 1,4,5,6,7,8-hexahydropyrrolo[2,3-c]azepine |
|---|---|
| PubChem CID | 58443090 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1,4,5,6,7,8-hexahydropyrrolo[2,3-c]azepine |
| SMILES | c1cc2c([nH]1)CNCCC2 |
| InChI | InChI=1S/C8H12N2/c1-2-7-3-5-10-8(7)6-9-4-1/h3,5,9-10H,1-2,4,6H2 |
| InChIKey | SYDPVKIJTFWSMJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |