C9H12N2 — CID 177251607
(5Z)-4,7,8,9-tetrahydro-1H-pyrrolo[2,3-c]azocine (PubChem CID 177251607) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is (5Z)-4,7,8,9-tetrahydro-1H-pyrrolo[2,3-c]azocine.
| Compound Name | (5Z)-4,7,8,9-tetrahydro-1H-pyrrolo[2,3-c]azocine |
|---|---|
| PubChem CID | 177251607 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (5Z)-4,7,8,9-tetrahydro-1H-pyrrolo[2,3-c]azocine |
| SMILES | C1=C\Cc2cc[nH]c2CNC/1 |
| InChI | InChI=1S/C9H12N2/c1-2-5-10-7-9-8(3-1)4-6-11-9/h1-2,4,6,10-11H,3,5,7H2/b2-1- |
| InChIKey | AXKYMMJGHDJZAA-UPHRSURJSA-N |
| XLogP | 1.22 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|