C10H9NO — CID 143158045
2,5-dihydrocyclohepta[c]pyridin-1-one (PubChem CID 143158045) has the molecular formula C10H9NO and a molecular weight of 159.19 g/mol. Its IUPAC name is 2,5-dihydrocyclohepta[c]pyridin-1-one.
| Compound Name | 2,5-dihydrocyclohepta[c]pyridin-1-one |
|---|---|
| PubChem CID | 143158045 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2,5-dihydrocyclohepta[c]pyridin-1-one |
| SMILES | O=c1[nH]ccc2c1C=CC=CC2 |
| InChI | InChI=1S/C10H9NO/c12-10-9-5-3-1-2-4-8(9)6-7-11-10/h1-3,5-7H,4H2,(H,11,12) |
| InChIKey | PSZMRIPXJANBIW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |