About 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile
6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile (PubChem CID 163914109) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile |
| PubChem CID | 163914109 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile |
| SMILES | N#CC1(N)Cc2cc[nH]c(=O)c2C1 |
| InChI | InChI=1S/C9H9N3O/c10-5-9(11)3-6-1-2-12-8(13)7(6)4-9/h1-2H,3-4,11H2,(H,12,13) |
| InChIKey | QUSLJHYRSKLSOH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile?
The IUPAC name of 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile (CID 163914109) is 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile.
What is the SMILES notation for 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile?
The canonical SMILES for 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile is N#CC1(N)Cc2cc[nH]c(=O)c2C1.
What is the InChIKey of 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile?
The InChIKey is QUSLJHYRSKLSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c10-5-9(11)3-6-1-2-12-8(13)7(6)4-9/h1-2H,3-4,11H2,(H,12,13).
What are the key properties of 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile?
6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile has a molecular weight of 175.19 g/mol, XLogP of -0.31, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1-oxo-5,7-dihydro-2H-cyclopenta[c]pyridine-6-carbonitrile is sourced from PubChem (CID 163914109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).