C9H8N2O2 — CID 158182969
2-methylidene-4,6-dihydro-1H-1,6-naphthyridine-3,5-dione (PubChem CID 158182969) has the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. Its IUPAC name is 2-methylidene-4,6-dihydro-1H-1,6-naphthyridine-3,5-dione.
| Compound Name | 2-methylidene-4,6-dihydro-1H-1,6-naphthyridine-3,5-dione |
|---|---|
| PubChem CID | 158182969 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 2-methylidene-4,6-dihydro-1H-1,6-naphthyridine-3,5-dione |
| SMILES | C=C1Nc2cc[nH]c(=O)c2CC1=O |
| InChI | InChI=1S/C9H8N2O2/c1-5-8(12)4-6-7(11-5)2-3-10-9(6)13/h2-3,11H,1,4H2,(H,10,13) |
| InChIKey | ZMXWJPWXARCBRM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|