C8H6N2O3 — CID 58286731
4,6-dihydro-1H-1,6-naphthyridine-2,3,5-trione (PubChem CID 58286731) has the molecular formula C8H6N2O3 and a molecular weight of 178.15 g/mol. Its IUPAC name is 4,6-dihydro-1H-1,6-naphthyridine-2,3,5-trione.
| Compound Name | 4,6-dihydro-1H-1,6-naphthyridine-2,3,5-trione |
|---|---|
| PubChem CID | 58286731 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 4,6-dihydro-1H-1,6-naphthyridine-2,3,5-trione |
| SMILES | O=C1Cc2c(cc[nH]c2=O)NC1=O |
| InChI | InChI=1S/C8H6N2O3/c11-6-3-4-5(10-8(6)13)1-2-9-7(4)12/h1-2H,3H2,(H,9,12)(H,10,13) |
| InChIKey | HUIVQAIWTOKXFV-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|