C7H4CaN2O5 — CID 175535209
calcium;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;carbonate (PubChem CID 175535209) has the molecular formula C7H4CaN2O5 and a molecular weight of 236.20 g/mol. Its IUPAC name is calcium;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;carbonate.
| Compound Name | calcium;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;carbonate |
|---|---|
| PubChem CID | 175535209 |
| Molecular Formula | C7H4CaN2O5 |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | calcium;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;carbonate |
| SMILES | O=C([O-])[O-].O=C1Nc2cc[nH]c2C1=O.[Ca+2] |
| InChI | InChI=1S/C6H4N2O2.CH2O3.Ca/c9-5-4-3(1-2-7-4)8-6(5)10;2-1(3)4;/h1-2,7H,(H,8,9,10);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | HWNJLVSALOENBJ-UHFFFAOYSA-L |
| XLogP | -2.68 |
| TPSA | 125.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|