C14H8N2O2S3 — CID 175241092
1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;3,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene (PubChem CID 175241092) has the molecular formula C14H8N2O2S3 and a molecular weight of 332.43 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;3,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene.
| Compound Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;3,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
|---|---|
| PubChem CID | 175241092 |
| Molecular Formula | C14H8N2O2S3 |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;3,7,9-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,10-tetraene |
| SMILES | O=C1Nc2cc[nH]c2C1=O.c1cc2c(s1)sc1ccsc12 |
| InChI | InChI=1S/C8H4S3.C6H4N2O2/c1-3-10-8-5(1)7-6(11-8)2-4-9-7;9-5-4-3(1-2-7-4)8-6(5)10/h1-4H;1-2,7H,(H,8,9,10) |
| InChIKey | SIVZGNBQTQAQBO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|