C9H11N3O5 — CID 173032765
(2S)-2-amino-3-hydroxypropanoic acid;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 173032765) has the molecular formula C9H11N3O5 and a molecular weight of 241.20 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 173032765 |
| Molecular Formula | C9H11N3O5 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | N[C@@H](CO)C(=O)O.O=C1Nc2cc[nH]c2C1=O |
| InChI | InChI=1S/C6H4N2O2.C3H7NO3/c9-5-4-3(1-2-7-4)8-6(5)10;4-2(1-5)3(6)7/h1-2,7H,(H,8,9,10);2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | OPEKAPIWYANVSN-WNQIDUERSA-N |
| XLogP | -1.46 |
| TPSA | 145.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|