C11H10N2O4 — CID 11651578
(2S)-2-amino-3-(2,3-dioxo-1H-indol-5-yl)propanoic acid (PubChem CID 11651578) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is (2S)-2-amino-3-(2,3-dioxo-1H-indol-5-yl)propanoic acid.
| Compound Name | (2S)-2-amino-3-(2,3-dioxo-1H-indol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 11651578 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | (2S)-2-amino-3-(2,3-dioxo-1H-indol-5-yl)propanoic acid |
| SMILES | N[C@@H](Cc1ccc2c(c1)C(=O)C(=O)N2)C(=O)O |
| InChI | InChI=1S/C11H10N2O4/c12-7(11(16)17)4-5-1-2-8-6(3-5)9(14)10(15)13-8/h1-3,7H,4,12H2,(H,16,17)(H,13,14,15)/t7-/m0/s1 |
| InChIKey | GYVRRFDJGZQPPK-ZETCQYMHSA-N |
| XLogP | -0.22 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|