C12H13NO2 — CID 13036487
5-(2-methylpropyl)-1H-indole-2,3-dione (PubChem CID 13036487) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-(2-methylpropyl)-1H-indole-2,3-dione.
| Compound Name | 5-(2-methylpropyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 13036487 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-(2-methylpropyl)-1H-indole-2,3-dione |
| SMILES | CC(C)Cc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C12H13NO2/c1-7(2)5-8-3-4-10-9(6-8)11(14)12(15)13-10/h3-4,6-7H,5H2,1-2H3,(H,13,14,15) |
| InChIKey | BYJCGSYNQXKHKK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|