C7H10N2O5 — CID 160632774
(2S)-2-amino-3-hydroxypropanoic acid;pyrrole-2,5-dione (PubChem CID 160632774) has the molecular formula C7H10N2O5 and a molecular weight of 202.17 g/mol. Its IUPAC name is (2S)-2-amino-3-hydroxypropanoic acid;pyrrole-2,5-dione.
| Compound Name | (2S)-2-amino-3-hydroxypropanoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 160632774 |
| Molecular Formula | C7H10N2O5 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (2S)-2-amino-3-hydroxypropanoic acid;pyrrole-2,5-dione |
| SMILES | N[C@@H](CO)C(=O)O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C3H7NO3/c6-3-1-2-4(7)5-3;4-2(1-5)3(6)7/h1-2H,(H,5,6,7);2,5H,1,4H2,(H,6,7)/t;2-/m.0/s1 |
| InChIKey | RIDBYVJDEIKJPK-WNQIDUERSA-N |
| XLogP | -2.41 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|