C18H14N2O2S3 — CID 175487267
1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;thiophene;2-thiophen-2-ylthiophene (PubChem CID 175487267) has the molecular formula C18H14N2O2S3 and a molecular weight of 386.52 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;thiophene;2-thiophen-2-ylthiophene.
| Compound Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;thiophene;2-thiophen-2-ylthiophene |
|---|---|
| PubChem CID | 175487267 |
| Molecular Formula | C18H14N2O2S3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione;thiophene;2-thiophen-2-ylthiophene |
| SMILES | O=C1Nc2cc[nH]c2C1=O.c1ccsc1.c1csc(-c2cccs2)c1 |
| InChI | InChI=1S/C8H6S2.C6H4N2O2.C4H4S/c1-3-7(9-5-1)8-4-2-6-10-8;9-5-4-3(1-2-7-4)8-6(5)10;1-2-4-5-3-1/h1-6H;1-2,7H,(H,8,9,10);1-4H |
| InChIKey | WPKIFNOQSSEVHT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|