C16H10N2O2S3 — CID 174225728
thieno[3,2-b]thiophene;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 174225728) has the molecular formula C16H10N2O2S3 and a molecular weight of 358.47 g/mol. Its IUPAC name is thieno[3,2-b]thiophene;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | thieno[3,2-b]thiophene;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 174225728 |
| Molecular Formula | C16H10N2O2S3 |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 357.99 |
| IUPAC Name | thieno[3,2-b]thiophene;2-thiophen-2-yl-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2cc(-c3cccs3)[nH]c2C1=O.c1cc2sccc2s1 |
| InChI | InChI=1S/C10H6N2O2S.C6H4S2/c13-9-8-6(12-10(9)14)4-5(11-8)7-2-1-3-15-7;1-3-7-6-2-4-8-5(1)6/h1-4,11H,(H,12,13,14);1-4H |
| InChIKey | GLMSIFUQTRVMOF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|