C13H12N2S2 — CID 54273607
(2,5-dithiophen-2-yl-1H-pyrrol-3-yl)methanamine (PubChem CID 54273607) has the molecular formula C13H12N2S2 and a molecular weight of 260.39 g/mol. Its IUPAC name is (2,5-dithiophen-2-yl-1H-pyrrol-3-yl)methanamine.
| Compound Name | (2,5-dithiophen-2-yl-1H-pyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 54273607 |
| Molecular Formula | C13H12N2S2 |
| Molecular Weight | 260.39 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | (2,5-dithiophen-2-yl-1H-pyrrol-3-yl)methanamine |
| SMILES | NCc1cc(-c2cccs2)[nH]c1-c1cccs1 |
| InChI | InChI=1S/C13H12N2S2/c14-8-9-7-10(11-3-1-5-16-11)15-13(9)12-4-2-6-17-12/h1-7,15H,8,14H2 |
| InChIKey | RLVZILMFZKDEPZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |