C12H7F2NS — CID 131867723
4,7-difluoro-2-thiophen-2-yl-1H-indole (PubChem CID 131867723) has the molecular formula C12H7F2NS and a molecular weight of 235.26 g/mol. Its IUPAC name is 4,7-difluoro-2-thiophen-2-yl-1H-indole.
| Compound Name | 4,7-difluoro-2-thiophen-2-yl-1H-indole |
|---|---|
| PubChem CID | 131867723 |
| Molecular Formula | C12H7F2NS |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 4,7-difluoro-2-thiophen-2-yl-1H-indole |
| SMILES | Fc1ccc(F)c2[nH]c(-c3cccs3)cc12 |
| InChI | InChI=1S/C12H7F2NS/c13-8-3-4-9(14)12-7(8)6-10(15-12)11-2-1-5-16-11/h1-6,15H |
| InChIKey | XZCGARIKPNWBFC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |