C13H11NS2 — CID 53445362
3-methyl-2,5-dithiophen-2-yl-1H-pyrrole (PubChem CID 53445362) has the molecular formula C13H11NS2 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-methyl-2,5-dithiophen-2-yl-1H-pyrrole.
| Compound Name | 3-methyl-2,5-dithiophen-2-yl-1H-pyrrole |
|---|---|
| PubChem CID | 53445362 |
| Molecular Formula | C13H11NS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 3-methyl-2,5-dithiophen-2-yl-1H-pyrrole |
| SMILES | Cc1cc(-c2cccs2)[nH]c1-c1cccs1 |
| InChI | InChI=1S/C13H11NS2/c1-9-8-10(11-4-2-6-15-11)14-13(9)12-5-3-7-16-12/h2-8,14H,1H3 |
| InChIKey | WIFINVVIAGBNRL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |