C6H4N2O3 — CID 174918402
2-hydroxy-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione (PubChem CID 174918402) has the molecular formula C6H4N2O3 and a molecular weight of 152.11 g/mol. Its IUPAC name is 2-hydroxy-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione.
| Compound Name | 2-hydroxy-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
|---|---|
| PubChem CID | 174918402 |
| Molecular Formula | C6H4N2O3 |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 2-hydroxy-1,4-dihydropyrrolo[3,2-b]pyrrole-5,6-dione |
| SMILES | O=C1Nc2cc(O)[nH]c2C1=O |
| InChI | InChI=1S/C6H4N2O3/c9-3-1-2-4(8-3)5(10)6(11)7-2/h1,8-9H,(H,7,10,11) |
| InChIKey | NPBXZHHBIGMNND-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|