About N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide
N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide (PubChem CID 119088471) has the molecular formula C10H8N2O4
and a molecular weight of 220.18 g/mol. Its IUPAC name is N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide |
| PubChem CID | 119088471 |
| Molecular Formula | C10H8N2O4 |
| Molecular Weight | 220.18 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide |
| SMILES | CC(=O)Nc1cc2c(cc1O)NC(=O)C2=O |
| InChI | InChI=1S/C10H8N2O4/c1-4(13)11-7-2-5-6(3-8(7)14)12-10(16)9(5)15/h2-3,14H,1H3,(H,11,13)(H,12,15,16) |
| InChIKey | RYCKTQUSQQTGEJ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide?
The IUPAC name of N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide (CID 119088471) is N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide.
What is the SMILES notation for N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide?
The canonical SMILES for N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide is CC(=O)Nc1cc2c(cc1O)NC(=O)C2=O.
What is the InChIKey of N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide?
The InChIKey is RYCKTQUSQQTGEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O4/c1-4(13)11-7-2-5-6(3-8(7)14)12-10(16)9(5)15/h2-3,14H,1H3,(H,11,13)(H,12,15,16).
What are the key properties of N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide?
N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide has a molecular weight of 220.18 g/mol, XLogP of 0.49, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-hydroxy-2,3-dioxo-1H-indol-5-yl)acetamide is sourced from PubChem (CID 119088471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).