C20H19NO7 — CID 157361158
2-[4-(carboxymethyl)-5-hydroxy-2-methylphenyl]acetic acid;5-methyl-1H-indole-2,3-dione (PubChem CID 157361158) has the molecular formula C20H19NO7 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[4-(carboxymethyl)-5-hydroxy-2-methylphenyl]acetic acid;5-methyl-1H-indole-2,3-dione.
| Compound Name | 2-[4-(carboxymethyl)-5-hydroxy-2-methylphenyl]acetic acid;5-methyl-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 157361158 |
| Molecular Formula | C20H19NO7 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 2-[4-(carboxymethyl)-5-hydroxy-2-methylphenyl]acetic acid;5-methyl-1H-indole-2,3-dione |
| SMILES | Cc1cc(CC(=O)O)c(O)cc1CC(=O)O.Cc1ccc2c(c1)C(=O)C(=O)N2 |
| InChI | InChI=1S/C11H12O5.C9H7NO2/c1-6-2-8(5-11(15)16)9(12)3-7(6)4-10(13)14;1-5-2-3-7-6(4-5)8(11)9(12)10-7/h2-3,12H,4-5H2,1H3,(H,13,14)(H,15,16);2-4H,1H3,(H,10,11,12) |
| InChIKey | BIQQGLYZLMTDEB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|