C16H10N2O2S — CID 16794953
5-(6-methyl-1,3-benzothiazol-2-yl)-1H-indole-2,3-dione (PubChem CID 16794953) has the molecular formula C16H10N2O2S and a molecular weight of 294.34 g/mol. Its IUPAC name is 5-(6-methyl-1,3-benzothiazol-2-yl)-1H-indole-2,3-dione.
| Compound Name | 5-(6-methyl-1,3-benzothiazol-2-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 16794953 |
| Molecular Formula | C16H10N2O2S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 5-(6-methyl-1,3-benzothiazol-2-yl)-1H-indole-2,3-dione |
| SMILES | Cc1ccc2nc(-c3ccc4c(c3)C(=O)C(=O)N4)sc2c1 |
| InChI | InChI=1S/C16H10N2O2S/c1-8-2-4-12-13(6-8)21-16(18-12)9-3-5-11-10(7-9)14(19)15(20)17-11/h2-7H,1H3,(H,17,19,20) |
| InChIKey | OOINJCDTEPHHPC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|