C18H13N5NaO6S2 — CID 170854368
CID 170854368 (PubChem CID 170854368) has the molecular formula C18H13N5NaO6S2 and a molecular weight of 482.46 g/mol.
| Compound Name | CID 170854368 |
|---|---|
| PubChem CID | 170854368 |
| Molecular Formula | C18H13N5NaO6S2 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.02 |
| IUPAC Name | — |
| SMILES | Cc1ccc2nc(-c3ccc(/N=N/C4C(=O)NC(=O)NC4=O)c(S(=O)(=O)O)c3)sc2c1.[Na] |
| InChI | InChI=1S/C18H13N5O6S2.Na/c1-8-2-4-10-12(6-8)30-17(19-10)9-3-5-11(13(7-9)31(27,28)29)22-23-14-15(24)20-18(26)21-16(14)25;/h2-7,14H,1H3,(H,27,28,29)(H2,20,21,24,25,26);/b23-22+; |
| InChIKey | VBYCKGUFEUZPSN-PGCQSHBKSA-N |
| XLogP | 1.96 |
| TPSA | 167.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|