C17H19N3O2S2 — CID 110620092
4-(6-methyl-1,3-benzothiazol-2-yl)-N-(propylsulfamoyl)aniline (PubChem CID 110620092) has the molecular formula C17H19N3O2S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(propylsulfamoyl)aniline.
| Compound Name | 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(propylsulfamoyl)aniline |
|---|---|
| PubChem CID | 110620092 |
| Molecular Formula | C17H19N3O2S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 4-(6-methyl-1,3-benzothiazol-2-yl)-N-(propylsulfamoyl)aniline |
| SMILES | CCCNS(=O)(=O)Nc1ccc(-c2nc3ccc(C)cc3s2)cc1 |
| InChI | InChI=1S/C17H19N3O2S2/c1-3-10-18-24(21,22)20-14-7-5-13(6-8-14)17-19-15-9-4-12(2)11-16(15)23-17/h4-9,11,18,20H,3,10H2,1-2H3 |
| InChIKey | RMMOSWBCHVCDCA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |