C18H18N2O3S2 — CID 110620089
N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-methylsulfonylpropanamide (PubChem CID 110620089) has the molecular formula C18H18N2O3S2 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-methylsulfonylpropanamide.
| Compound Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 110620089 |
| Molecular Formula | C18H18N2O3S2 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[4-(6-methyl-1,3-benzothiazol-2-yl)phenyl]-3-methylsulfonylpropanamide |
| SMILES | Cc1ccc2nc(-c3ccc(NC(=O)CCS(C)(=O)=O)cc3)sc2c1 |
| InChI | InChI=1S/C18H18N2O3S2/c1-12-3-8-15-16(11-12)24-18(20-15)13-4-6-14(7-5-13)19-17(21)9-10-25(2,22)23/h3-8,11H,9-10H2,1-2H3,(H,19,21) |
| InChIKey | GCOHKSGVMUEYPR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |