About N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide
N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide (PubChem CID 139679936) has the molecular formula C15H16N2O3
and a molecular weight of 272.30 g/mol. Its IUPAC name is N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide.
Molecular Properties
| Compound Name | N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide |
| PubChem CID | 139679936 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(O)c(Nc2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C15H16N2O3/c1-9-3-5-11(6-4-9)17-13-8-14(19)12(7-15(13)20)16-10(2)18/h3-8,17,19-20H,1-2H3,(H,16,18) |
| InChIKey | XVQOHQHJAIXVAA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide?
The IUPAC name of N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide (CID 139679936) is N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide.
What is the SMILES notation for N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide?
The canonical SMILES for N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide is CC(=O)Nc1cc(O)c(Nc2ccc(C)cc2)cc1O.
What is the InChIKey of N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide?
The InChIKey is XVQOHQHJAIXVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O3/c1-9-3-5-11(6-4-9)17-13-8-14(19)12(7-15(13)20)16-10(2)18/h3-8,17,19-20H,1-2H3,(H,16,18).
What are the key properties of N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide?
N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide has a molecular weight of 272.30 g/mol, XLogP of 3.11, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2,5-dihydroxy-4-(4-methylanilino)phenyl]acetamide is sourced from PubChem (CID 139679936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).