C8H12AsNO5+2 — CID 174446645
(3-acetamido-4-hydroxyphenyl)arsonic acid;hydron (PubChem CID 174446645) has the molecular formula C8H12AsNO5+2 and a molecular weight of 277.11 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;hydron.
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;hydron |
|---|---|
| PubChem CID | 174446645 |
| Molecular Formula | C8H12AsNO5+2 |
| Molecular Weight | 277.11 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;hydron |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.[H+].[H+] |
| InChI | InChI=1S/C8H10AsNO5/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h2-4,12H,1H3,(H,10,11)(H2,13,14,15)/p+2 |
| InChIKey | ODFJOVXVLFUVNQ-UHFFFAOYSA-P |
| XLogP | -0.86 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.11 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|