C18H20AsNO7 — CID 174605336
(3-acetamido-4-hydroxyphenyl)-(2-hydroxy-4-phenylbutanoyl)oxyarsinic acid (PubChem CID 174605336) has the molecular formula C18H20AsNO7 and a molecular weight of 437.28 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)-(2-hydroxy-4-phenylbutanoyl)oxyarsinic acid.
| Compound Name | (3-acetamido-4-hydroxyphenyl)-(2-hydroxy-4-phenylbutanoyl)oxyarsinic acid |
|---|---|
| PubChem CID | 174605336 |
| Molecular Formula | C18H20AsNO7 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)-(2-hydroxy-4-phenylbutanoyl)oxyarsinic acid |
| SMILES | CC(=O)Nc1cc([As](=O)(O)OC(=O)C(O)CCc2ccccc2)ccc1O |
| InChI | InChI=1S/C18H20AsNO7/c1-12(21)20-15-11-14(8-10-16(15)22)19(25,26)27-18(24)17(23)9-7-13-5-3-2-4-6-13/h2-6,8,10-11,17,22-23H,7,9H2,1H3,(H,20,21)(H,25,26) |
| InChIKey | JAROFEDUMSYQKN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|