About (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide
(3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide (PubChem CID 174311385) has the molecular formula C20H27AsN2O6
and a molecular weight of 466.37 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide.
Molecular Properties
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide |
| PubChem CID | 174311385 |
| Molecular Formula | C20H27AsN2O6 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 466.11 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CCC(C)CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H17NO.C8H10AsNO5/c1-3-10(2)9-13-12(14)11-7-5-4-6-8-11;1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h4-8,10H,3,9H2,1-2H3,(H,13,14);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | PEVQJIAJNYFKHJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide?
The IUPAC name of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide (CID 174311385) is (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide.
What is the SMILES notation for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide?
The canonical SMILES for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide is CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CCC(C)CNC(=O)c1ccccc1.
What is the InChIKey of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide?
The InChIKey is PEVQJIAJNYFKHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO.C8H10AsNO5/c1-3-10(2)9-13-12(14)11-7-5-4-6-8-11;1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h4-8,10H,3,9H2,1-2H3,(H,13,14);2-4,12H,1H3,(H,10,11)(H2,13,14,15).
What are the key properties of (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide?
(3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide has a molecular weight of 466.37 g/mol, XLogP of 1.37, 6 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-acetamido-4-hydroxyphenyl)arsonic acid;N-(2-methylbutyl)benzamide is sourced from PubChem (CID 174311385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).