C10H15AsN2O7 — CID 174387815
(3-acetamido-4-hydroxyphenyl)arsonic acid;2-aminoacetic acid (PubChem CID 174387815) has the molecular formula C10H15AsN2O7 and a molecular weight of 350.16 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;2-aminoacetic acid.
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2-aminoacetic acid |
|---|---|
| PubChem CID | 174387815 |
| Molecular Formula | C10H15AsN2O7 |
| Molecular Weight | 350.16 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2-aminoacetic acid |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.NCC(=O)O |
| InChI | InChI=1S/C8H10AsNO5.C2H5NO2/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12;3-1-2(4)5/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);1,3H2,(H,4,5) |
| InChIKey | WCVXWOQFLMXCIV-UHFFFAOYSA-N |
| XLogP | -2.06 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.16 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|