C8H11AsN2O5 — CID 150637413
(6-acetamido-2-amino-3-hydroxyphenyl)arsonic acid (PubChem CID 150637413) has the molecular formula C8H11AsN2O5 and a molecular weight of 290.11 g/mol. Its IUPAC name is (6-acetamido-2-amino-3-hydroxyphenyl)arsonic acid.
| Compound Name | (6-acetamido-2-amino-3-hydroxyphenyl)arsonic acid |
|---|---|
| PubChem CID | 150637413 |
| Molecular Formula | C8H11AsN2O5 |
| Molecular Weight | 290.11 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | (6-acetamido-2-amino-3-hydroxyphenyl)arsonic acid |
| SMILES | CC(=O)Nc1ccc(O)c(N)c1[As](=O)(O)O |
| InChI | InChI=1S/C8H11AsN2O5/c1-4(12)11-5-2-3-6(13)8(10)7(5)9(14,15)16/h2-3,13H,10H2,1H3,(H,11,12)(H2,14,15,16) |
| InChIKey | IZEHWAABKLBYGC-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.11 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|