C14H23AsN2O6 — CID 174365729
(3-acetamido-4-hydroxyphenyl)arsonic acid;piperidin-1-ylmethanol (PubChem CID 174365729) has the molecular formula C14H23AsN2O6 and a molecular weight of 390.27 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;piperidin-1-ylmethanol.
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;piperidin-1-ylmethanol |
|---|---|
| PubChem CID | 174365729 |
| Molecular Formula | C14H23AsN2O6 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;piperidin-1-ylmethanol |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.OCN1CCCCC1 |
| InChI | InChI=1S/C8H10AsNO5.C6H13NO/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12;8-6-7-4-2-1-3-5-7/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);8H,1-6H2 |
| InChIKey | GPFFFODNXASRDS-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|