C19H19AsF3NO6 — CID 174724250
(3-acetamido-4-hydroxyphenyl)-[(4R)-4-(2,4,5-trifluorophenyl)pentanoyl]oxyarsinic acid (PubChem CID 174724250) has the molecular formula C19H19AsF3NO6 and a molecular weight of 489.28 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)-[(4R)-4-(2,4,5-trifluorophenyl)pentanoyl]oxyarsinic acid.
| Compound Name | (3-acetamido-4-hydroxyphenyl)-[(4R)-4-(2,4,5-trifluorophenyl)pentanoyl]oxyarsinic acid |
|---|---|
| PubChem CID | 174724250 |
| Molecular Formula | C19H19AsF3NO6 |
| Molecular Weight | 489.28 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)-[(4R)-4-(2,4,5-trifluorophenyl)pentanoyl]oxyarsinic acid |
| SMILES | CC(=O)Nc1cc([As](=O)(O)OC(=O)CC[C@@H](C)c2cc(F)c(F)cc2F)ccc1O |
| InChI | InChI=1S/C19H19AsF3NO6/c1-10(13-8-15(22)16(23)9-14(13)21)3-6-19(27)30-20(28,29)12-4-5-18(26)17(7-12)24-11(2)25/h4-5,7-10,26H,3,6H2,1-2H3,(H,24,25)(H,28,29)/t10-/m1/s1 |
| InChIKey | GJSGJMYGTLBQPW-SNVBAGLBSA-N |
| XLogP | 2.46 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.28 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|