C15H22AsNO9 — CID 174257876
(3-acetamido-4-hydroxyphenyl)arsonic acid;2-ethoxycarbonylbutanoic acid (PubChem CID 174257876) has the molecular formula C15H22AsNO9 and a molecular weight of 435.26 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;2-ethoxycarbonylbutanoic acid.
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2-ethoxycarbonylbutanoic acid |
|---|---|
| PubChem CID | 174257876 |
| Molecular Formula | C15H22AsNO9 |
| Molecular Weight | 435.26 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2-ethoxycarbonylbutanoic acid |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CCOC(=O)C(CC)C(=O)O |
| InChI | InChI=1S/C8H10AsNO5.C7H12O4/c1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12;1-3-5(6(8)9)7(10)11-4-2/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);5H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | INKXPVXTTQTXAZ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 170.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.26 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|