C17H29AsN2O6 — CID 174432735
(3-acetamido-4-hydroxyphenyl)arsonic acid;2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium (PubChem CID 174432735) has the molecular formula C17H29AsN2O6 and a molecular weight of 432.35 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)arsonic acid;2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium.
| Compound Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 174432735 |
| Molecular Formula | C17H29AsN2O6 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)arsonic acid;2,2,6,6-tetramethyl-1-oxidopiperidin-1-ium |
| SMILES | CC(=O)Nc1cc([As](=O)(O)O)ccc1O.CC1(C)CCCC(C)(C)[NH+]1[O-] |
| InChI | InChI=1S/C9H19NO.C8H10AsNO5/c1-8(2)6-5-7-9(3,4)10(8)11;1-5(11)10-7-4-6(9(13,14)15)2-3-8(7)12/h10H,5-7H2,1-4H3;2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | AOEIKHKZGIIULW-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|