C15H13AsBrNO6 — CID 174793571
(3-acetamido-4-hydroxyphenyl)-(3-bromobenzoyl)oxyarsinic acid (PubChem CID 174793571) has the molecular formula C15H13AsBrNO6 and a molecular weight of 458.10 g/mol. Its IUPAC name is (3-acetamido-4-hydroxyphenyl)-(3-bromobenzoyl)oxyarsinic acid.
| Compound Name | (3-acetamido-4-hydroxyphenyl)-(3-bromobenzoyl)oxyarsinic acid |
|---|---|
| PubChem CID | 174793571 |
| Molecular Formula | C15H13AsBrNO6 |
| Molecular Weight | 458.10 g/mol |
| Exact Mass | 456.91 |
| IUPAC Name | (3-acetamido-4-hydroxyphenyl)-(3-bromobenzoyl)oxyarsinic acid |
| SMILES | CC(=O)Nc1cc([As](=O)(O)OC(=O)c2cccc(Br)c2)ccc1O |
| InChI | InChI=1S/C15H13AsBrNO6/c1-9(19)18-13-8-11(5-6-14(13)20)16(22,23)24-15(21)10-3-2-4-12(17)7-10/h2-8,20H,1H3,(H,18,19)(H,22,23) |
| InChIKey | RPOFIOWMXPRQON-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.10 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|