C15H15AsBrNO7 — CID 175313763
(4-acetamido-2-hydroxyphenyl)arsonic acid;3-bromobenzoic acid (PubChem CID 175313763) has the molecular formula C15H15AsBrNO7 and a molecular weight of 476.11 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;3-bromobenzoic acid.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-bromobenzoic acid |
|---|---|
| PubChem CID | 175313763 |
| Molecular Formula | C15H15AsBrNO7 |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 474.92 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-bromobenzoic acid |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.O=C(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C8H10AsNO5.C7H5BrO2/c1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15;8-6-3-1-2-5(4-6)7(9)10/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);1-4H,(H,9,10) |
| InChIKey | KKAKZEVNYHUOJM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|