About (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid
(2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid (PubChem CID 175248281) has the molecular formula C23H22AsNO7
and a molecular weight of 499.35 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid.
Molecular Properties
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid |
| PubChem CID | 175248281 |
| Molecular Formula | C23H22AsNO7 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.O=C(O)c1cccc(C=Cc2ccccc2)c1 |
| InChI | InChI=1S/C15H12O2.C8H10AsNO5/c16-15(17)14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12;1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12/h1-11H,(H,16,17);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | NBUGBPJPGYQYNJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid?
The IUPAC name of (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid (CID 175248281) is (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid.
What is the SMILES notation for (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid?
The canonical SMILES for (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid is CC(=O)Nc1c(O)cccc1[As](=O)(O)O.O=C(O)c1cccc(C=Cc2ccccc2)c1.
What is the InChIKey of (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid?
The InChIKey is NBUGBPJPGYQYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O2.C8H10AsNO5/c16-15(17)14-8-4-7-13(11-14)10-9-12-5-2-1-3-6-12;1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12/h1-11H,(H,16,17);2-4,12H,1H3,(H,10,11)(H2,13,14,15).
What are the key properties of (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid?
(2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid has a molecular weight of 499.35 g/mol, XLogP of 2.47, 5 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetamido-3-hydroxyphenyl)arsonic acid;3-(2-phenylethenyl)benzoic acid is sourced from PubChem (CID 175248281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).