C25H29AsClNO10 — CID 174759192
(2-acetamido-3-hydroxyphenyl)arsonic acid;diethyl 2-[2-[4-(2-chloroacetyl)phenyl]ethenyl]propanedioate (PubChem CID 174759192) has the molecular formula C25H29AsClNO10 and a molecular weight of 613.88 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;diethyl 2-[2-[4-(2-chloroacetyl)phenyl]ethenyl]propanedioate.
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;diethyl 2-[2-[4-(2-chloroacetyl)phenyl]ethenyl]propanedioate |
|---|---|
| PubChem CID | 174759192 |
| Molecular Formula | C25H29AsClNO10 |
| Molecular Weight | 613.88 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;diethyl 2-[2-[4-(2-chloroacetyl)phenyl]ethenyl]propanedioate |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.CCOC(=O)C(C=Cc1ccc(C(=O)CCl)cc1)C(=O)OCC |
| InChI | InChI=1S/C17H19ClO5.C8H10AsNO5/c1-3-22-16(20)14(17(21)23-4-2)10-7-12-5-8-13(9-6-12)15(19)11-18;1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12/h5-10,14H,3-4,11H2,1-2H3;2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | WCEVUPNUDRGROB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 176.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.88 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|