C13H20AsNO8 — CID 174902362
(2-acetamido-3-hydroxyphenyl)arsonic acid;methyl 3-methoxypropanoate (PubChem CID 174902362) has the molecular formula C13H20AsNO8 and a molecular weight of 393.22 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;methyl 3-methoxypropanoate.
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;methyl 3-methoxypropanoate |
|---|---|
| PubChem CID | 174902362 |
| Molecular Formula | C13H20AsNO8 |
| Molecular Weight | 393.22 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;methyl 3-methoxypropanoate |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.COCCC(=O)OC |
| InChI | InChI=1S/C8H10AsNO5.C5H10O3/c1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12;1-7-4-3-5(6)8-2/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);3-4H2,1-2H3 |
| InChIKey | BDZNBFSEQVEIEX-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.22 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|