C24H25AsF2N2O7 — CID 174467622
(2-acetamido-3-hydroxyphenyl)arsonic acid;N-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]propanamide (PubChem CID 174467622) has the molecular formula C24H25AsF2N2O7 and a molecular weight of 566.39 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;N-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]propanamide.
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;N-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 174467622 |
| Molecular Formula | C24H25AsF2N2O7 |
| Molecular Weight | 566.39 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;N-[2-fluoro-4-[(4-fluorophenyl)methoxy]phenyl]propanamide |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.CCC(=O)Nc1ccc(OCc2ccc(F)cc2)cc1F |
| InChI | InChI=1S/C16H15F2NO2.C8H10AsNO5/c1-2-16(20)19-15-8-7-13(9-14(15)18)21-10-11-3-5-12(17)6-4-11;1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12/h3-9H,2,10H2,1H3,(H,19,20);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | FMHMHTNTRCMIND-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|