C20H24N2O4 — CID 22033742
2-(propanoylamino)-5-[[3-(propylamino)phenyl]methoxy]benzoic acid (PubChem CID 22033742) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-(propanoylamino)-5-[[3-(propylamino)phenyl]methoxy]benzoic acid.
| Compound Name | 2-(propanoylamino)-5-[[3-(propylamino)phenyl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 22033742 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(propanoylamino)-5-[[3-(propylamino)phenyl]methoxy]benzoic acid |
| SMILES | CCCNc1cccc(COc2ccc(NC(=O)CC)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C20H24N2O4/c1-3-10-21-15-7-5-6-14(11-15)13-26-16-8-9-18(22-19(23)4-2)17(12-16)20(24)25/h5-9,11-12,21H,3-4,10,13H2,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | RPAFXFCJCMWUNV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |