C17H23AsF3NO7 — CID 162235594
(2-acetamido-3-hydroxyphenyl)arsonic acid;2-[2-(trifluoromethyl)cyclohexyl]acetic acid (PubChem CID 162235594) has the molecular formula C17H23AsF3NO7 and a molecular weight of 485.29 g/mol. Its IUPAC name is (2-acetamido-3-hydroxyphenyl)arsonic acid;2-[2-(trifluoromethyl)cyclohexyl]acetic acid.
| Compound Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;2-[2-(trifluoromethyl)cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 162235594 |
| Molecular Formula | C17H23AsF3NO7 |
| Molecular Weight | 485.29 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | (2-acetamido-3-hydroxyphenyl)arsonic acid;2-[2-(trifluoromethyl)cyclohexyl]acetic acid |
| SMILES | CC(=O)Nc1c(O)cccc1[As](=O)(O)O.O=C(O)CC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C9H13F3O2.C8H10AsNO5/c10-9(11,12)7-4-2-1-3-6(7)5-8(13)14;1-5(11)10-8-6(9(13,14)15)3-2-4-7(8)12/h6-7H,1-5H2,(H,13,14);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | ZVZYACJKRZVYRN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|