C17H20AsNO7 — CID 174637545
(4-acetamido-2-hydroxyphenyl)arsonic acid;3-ethylbenzoic acid (PubChem CID 174637545) has the molecular formula C17H20AsNO7 and a molecular weight of 425.27 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;3-ethylbenzoic acid.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-ethylbenzoic acid |
|---|---|
| PubChem CID | 174637545 |
| Molecular Formula | C17H20AsNO7 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;3-ethylbenzoic acid |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.CCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C9H10O2.C8H10AsNO5/c1-2-7-4-3-5-8(6-7)9(10)11;1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15/h3-6H,2H2,1H3,(H,10,11);2-4,12H,1H3,(H,10,11)(H2,13,14,15) |
| InChIKey | VRSLNGGLZLOMDM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|