C15H17AsClNO8S — CID 174774799
(4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride (PubChem CID 174774799) has the molecular formula C15H17AsClNO8S and a molecular weight of 481.74 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride.
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride |
|---|---|
| PubChem CID | 174774799 |
| Molecular Formula | C15H17AsClNO8S |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.COc1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H10AsNO5.C7H7ClO3S/c1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15;1-11-6-4-2-3-5-7(6)12(8,9)10/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);2-5H,1H3 |
| InChIKey | OWSYSPWJVWXDGQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|