About (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride
(4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride (PubChem CID 174774799) has the molecular formula C15H17AsClNO8S
and a molecular weight of 481.74 g/mol. Its IUPAC name is (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride.
Molecular Properties
| Compound Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride |
| PubChem CID | 174774799 |
| Molecular Formula | C15H17AsClNO8S |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 480.96 |
| IUPAC Name | (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride |
| SMILES | CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.COc1ccccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H10AsNO5.C7H7ClO3S/c1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15;1-11-6-4-2-3-5-7(6)12(8,9)10/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);2-5H,1H3 |
| InChIKey | OWSYSPWJVWXDGQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 150.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride?
The IUPAC name of (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride (CID 174774799) is (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride.
What is the SMILES notation for (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride?
The canonical SMILES for (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride is CC(=O)Nc1ccc([As](=O)(O)O)c(O)c1.COc1ccccc1S(=O)(=O)Cl.
What is the InChIKey of (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride?
The InChIKey is OWSYSPWJVWXDGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10AsNO5.C7H7ClO3S/c1-5(11)10-6-2-3-7(8(12)4-6)9(13,14)15;1-11-6-4-2-3-5-7(6)12(8,9)10/h2-4,12H,1H3,(H,10,11)(H2,13,14,15);2-5H,1H3.
What are the key properties of (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride?
(4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride has a molecular weight of 481.74 g/mol, XLogP of 0.53, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamido-2-hydroxyphenyl)arsonic acid;2-methoxybenzenesulfonyl chloride is sourced from PubChem (CID 174774799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).