C12H10ClN3O4S — CID 102921722
2-methoxy-4-(pyrimidine-5-carbonylamino)benzenesulfonyl chloride (PubChem CID 102921722) has the molecular formula C12H10ClN3O4S and a molecular weight of 327.75 g/mol. Its IUPAC name is 2-methoxy-4-(pyrimidine-5-carbonylamino)benzenesulfonyl chloride.
| Compound Name | 2-methoxy-4-(pyrimidine-5-carbonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 102921722 |
| Molecular Formula | C12H10ClN3O4S |
| Molecular Weight | 327.75 g/mol |
| Exact Mass | 327.01 |
| IUPAC Name | 2-methoxy-4-(pyrimidine-5-carbonylamino)benzenesulfonyl chloride |
| SMILES | COc1cc(NC(=O)c2cncnc2)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C12H10ClN3O4S/c1-20-10-4-9(2-3-11(10)21(13,18)19)16-12(17)8-5-14-7-15-6-8/h2-7H,1H3,(H,16,17) |
| InChIKey | SAVIKIRRTRPNJP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |