C11H10ClN3O4S — CID 63084251
2-methoxy-5-(1H-pyrazole-5-carbonylamino)benzenesulfonyl chloride (PubChem CID 63084251) has the molecular formula C11H10ClN3O4S and a molecular weight of 315.74 g/mol. Its IUPAC name is 2-methoxy-5-(1H-pyrazole-5-carbonylamino)benzenesulfonyl chloride.
| Compound Name | 2-methoxy-5-(1H-pyrazole-5-carbonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 63084251 |
| Molecular Formula | C11H10ClN3O4S |
| Molecular Weight | 315.74 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | 2-methoxy-5-(1H-pyrazole-5-carbonylamino)benzenesulfonyl chloride |
| SMILES | COc1ccc(NC(=O)c2ccn[nH]2)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H10ClN3O4S/c1-19-9-3-2-7(6-10(9)20(12,17)18)14-11(16)8-4-5-13-15-8/h2-6H,1H3,(H,13,15)(H,14,16) |
| InChIKey | KPBSNWNXNRIUHA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |